CAS 626-51-7
:3-Methylglutaric acid
Description:
3-Methylglutaric acid, with the CAS number 626-51-7, is a dicarboxylic acid characterized by its branched-chain structure. It features two carboxylic acid functional groups (-COOH) and a methyl group attached to the third carbon of a five-carbon chain. This compound is typically a colorless to pale yellow solid at room temperature and is soluble in water due to its polar carboxylic acid groups. It has applications in organic synthesis and can serve as an intermediate in the production of various chemicals. Additionally, 3-methylglutaric acid is of interest in biochemistry, particularly in metabolic studies, as it is involved in certain metabolic pathways and can be associated with specific metabolic disorders. Its derivatives may also be explored for their potential in pharmaceuticals and materials science. As with many organic acids, it exhibits acidic properties, contributing to its reactivity in various chemical reactions. Proper handling and storage are essential due to its potential to cause irritation upon contact.
Formula:C6H10O4
InChI:InChI=1S/C6H10O4/c1-4(2-5(7)8)3-6(9)10/h4H,2-3H2,1H3,(H,7,8)(H,9,10)
InChI key:InChIKey=XJMMNTGIMDZPMU-UHFFFAOYSA-N
SMILES:C(C(CC(O)=O)C)C(O)=O
Synonyms:- 2-Methylpentanedioic Acid
- 3-Methylpentanedioate
- 3-Methylpentanedioic Acid
- Glutaric acid, 3-methyl-
- Glutaric acid, β-methyl-
- Methylglutaricacid
- NSC 14870
- Pentanedioic acid, 3-methyl-
- β-Methylglutaric acid
- 3-Methylglutaric acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-Methylglutaric Acid
CAS:Formula:C6H10O4Purity:>99.0%(T)Color and Shape:White to Almost white powder to crystalineMolecular weight:146.143-Methylpentanedioic acid
CAS:Formula:C6H10O4Purity:98%Color and Shape:SolidMolecular weight:146.14123-Methylglutaric acid
CAS:Methylglutaric acid, a leucine byproduct, is linked to two metabolic disorders, detected in patient urine.Formula:C6H10O4Purity:98.64%Color and Shape:SolidMolecular weight:146.143-Methylglutaric Acid
CAS:Controlled ProductFormula:C6H10O4Color and Shape:NeatMolecular weight:146.143-Methylglutaric acid
CAS:<p>3-Methylglutaric acid is an organic compound that belongs to the group of alkanocarboxylic acids. It has been shown to reduce the formation of malonic acid, which can be toxic to the heart and cause congestive heart failure. 3-Methylglutaric acid also inhibits oxidation catalysts and increases the production of energy in cells by providing electrons. The kinetic data for 3-methylglutaric acid have been determined using a gas chromatography technique on a high-temperature conversion reactor at a pH of 7.0 with a concentration of 0.1 M potassium phosphate buffer (pH 7) and a temperature of 70°C. 3-Methylglutaric acid has been shown to inhibit monoclonal antibody cationic polymerization, which may be due to its reactive nature and its ability to donate hydrogen ions or electrons.</p>Formula:C6H10O4Purity:Min. 95%Molecular weight:146.14 g/mol






