CAS 62614-84-0
:4-(piperidin-4-yl)phenol
Description:
4-(Piperidin-4-yl)phenol, with the CAS number 62614-84-0, is an organic compound characterized by a phenolic structure substituted with a piperidine group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the piperidine ring contributes to its basicity and can influence its interaction with biological targets. The hydroxyl group (-OH) on the phenol moiety enhances its solubility in polar solvents and can participate in hydrogen bonding, which is significant for its reactivity and biological activity. Additionally, the compound may exhibit various properties such as antioxidant activity, making it of interest in research related to neuroprotection and other therapeutic areas. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C11H15NO
InChI:InChI=1/C11H15NO/c13-11-3-1-9(2-4-11)10-5-7-12-8-6-10/h1-4,10,12-13H,5-8H2
SMILES:c1cc(ccc1C1CCNCC1)O
Synonyms:- 4-Piperidin-4-Ylphenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(Piperidin-4-yl)phenol
CAS:4-(Piperidin-4-yl)phenol is a potent antipsychotic drug that belongs to the group of piperidines. It has been shown to be active in animal models and as an antipsychotic agent in humans. 4-(Piperidin-4-yl)phenol binds to alpha and beta adrenergic receptors, serotonin receptors, dopamine receptors, and histamine H1 receptors. It has been shown to have high potency and affinity for these receptors. This drug is also cloned from human brain tissue and has acted as a subtype-selective antagonist at cloned human alpha 1A-adrenergic receptor.
Formula:C11H15NOPurity:Min. 95%Molecular weight:177.25 g/mol


