CAS 626216-27-1

N2-[(2-Fluorophenyl)methyl]-N1,N1-dimethyl-1,2-ethanediamine

Description:

N2-[(2-Fluorophenyl)methyl]-N1,N1-dimethyl-1,2-ethanediamine, identified by its CAS number 626216-27-1, is a chemical compound characterized by its unique structure, which includes a fluorophenyl group and a dimethylated ethanediamine backbone. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in various solvents. The presence of the fluorine atom in the phenyl ring may enhance lipophilicity and alter the compound's reactivity and biological activity. Additionally, the dimethyl groups contribute to steric hindrance, potentially affecting the compound's interaction with biological targets. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The specific characteristics, including melting point, boiling point, and spectral data, would require experimental determination or literature reference for precise values. Overall, this compound represents a class of organic molecules that may exhibit interesting pharmacological properties due to its structural features.

Formula: C₁₁H₁₇FN₂

InChI: InChI=1S/C11H17FN2/c1-14(2)8-7-13-9-10-5-3-4-6-11(10)12/h3-6,13H,7-9H2,1-2H3

InChI key: InChIKey=HTBXSNPURUNNNU-UHFFFAOYSA-N

SMILES: C(NCCN(C)C)C1=C(F)C=CC=C1

Synonyms:

• 1,2-Ethanediamine, N2-[(2-fluorophenyl)methyl]-N1,N1-dimethyl-
• 1,2-Ethanediamine, N′-[(2-fluorophenyl)methyl]-N,N-dimethyl-
• [2-(Dimethylamino)ethyl][(2-fluorophenyl)methyl]amine
• N2-[(2-Fluorophenyl)methyl]-N1,N1-dimethyl-1,2-ethanediamine

[2-(Dimethylamino)ethyl][(2-fluorophenyl)methyl]amine

CAS: 626216-27-1

Versatile small molecule scaffold

Formula: C₁₁H₁₇FN₂

Purity: Min. 95%

Molecular weight: 196.26 g/mol

Ref: 3D-BAB21627