CAS 626216-69-1
:N-(4-Methylcyclohexyl)-3-pyridinemethanamine
Description:
N-(4-Methylcyclohexyl)-3-pyridinemethanamine, with the CAS number 626216-69-1, is a chemical compound characterized by its unique structure, which includes a pyridine ring and a cyclohexyl group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The methyl substitution on the cyclohexyl ring can influence its steric and electronic properties, potentially affecting its reactivity and interaction with biological systems. The pyridine moiety contributes to the compound's aromatic character, which can enhance its stability and solubility in organic solvents. Additionally, compounds like this may have applications in pharmaceuticals or as intermediates in organic synthesis, owing to their ability to participate in various chemical reactions. Overall, the specific characteristics, including melting point, boiling point, and solubility, would need to be determined through experimental data, as they can vary based on the compound's purity and environmental conditions.
Formula:C13H20N2
InChI:InChI=1S/C13H20N2/c1-11-4-6-13(7-5-11)15-10-12-3-2-8-14-9-12/h2-3,8-9,11,13,15H,4-7,10H2,1H3
InChI key:InChIKey=LIXDUPDEYUFILL-UHFFFAOYSA-N
SMILES:N(CC=1C=CC=NC1)C2CCC(C)CC2
Synonyms:- N-(4-Methylcyclohexyl)-3-pyridinemethanamine
- 3-Pyridinemethanamine, N-(4-methylcyclohexyl)-
- (4-METHYL-CYCLOHEXYL)-PYRIDIN-3-YLMETHYL-AMINE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.