
CAS 6263-37-2
:N-(3,4-Dichlorophenyl)-N-hydroxy-N′-methylurea
Description:
N-(3,4-Dichlorophenyl)-N-hydroxy-N′-methylurea, with the CAS number 6263-37-2, is an organic compound that belongs to the class of ureas. This substance features a urea functional group, characterized by the presence of a carbonyl group (C=O) bonded to two nitrogen atoms. The compound is distinguished by the presence of a 3,4-dichlorophenyl group, which contributes to its biological activity and potential applications in various fields, including agriculture and pharmaceuticals. The hydroxy group (-OH) attached to the nitrogen enhances its reactivity and solubility in polar solvents. This compound may exhibit herbicidal properties, making it of interest in agricultural chemistry. Its molecular structure suggests potential interactions with biological systems, which could lead to various pharmacological effects. As with many chemical substances, safety and handling precautions are essential due to potential toxicity or environmental impact. Proper storage and disposal methods should be followed to mitigate any risks associated with its use.
Formula:C8H8Cl2N2O2
InChI:InChI=1S/C8H8Cl2N2O2/c1-11-8(13)12(14)5-2-3-6(9)7(10)4-5/h2-4,14H,1H3,(H,11,13)
InChI key:InChIKey=BDEVAORUDIRFGE-UHFFFAOYSA-N
SMILES:N(C(NC)=O)(O)C1=CC(Cl)=C(Cl)C=C1
Synonyms:- Urea, N-(3,4-dichlorophenyl)-N-hydroxy-N′-methyl-
- N-(3,4-Dichlorophenyl)-N-hydroxy-N′-methylurea
- Urea, 1-(3,4-dichlorophenyl)-1-hydroxy-3-methyl-
- 1-(3,4-Dichlorophenyl)-1-hydroxy-3-methyl urea
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.