CAS 62642-62-0

4-(Morpholinomethyl)benzoic acid

Description:

4-(Morpholinomethyl)benzoic acid, with the CAS number 62642-62-0, is an organic compound characterized by its benzoic acid structure modified with a morpholinomethyl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of both hydrophobic aromatic and hydrophilic morpholine functionalities. It possesses a carboxylic acid functional group, which contributes to its acidic properties and potential reactivity in various chemical reactions, including esterification and amidation. The morpholine ring enhances its ability to interact with biological systems, making it of interest in pharmaceutical applications, particularly as a building block in drug synthesis or as a potential therapeutic agent. Additionally, its structural features may impart specific biological activities, such as antimicrobial or anti-inflammatory properties, although detailed studies would be necessary to elucidate these effects. Overall, 4-(Morpholinomethyl)benzoic acid is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₁₂H₁₅NO₃

InChI: InChI=1/C12H15NO3/c14-12(15)11-3-1-10(2-4-11)9-13-5-7-16-8-6-13/h1-4H,5-9H2,(H,14,15)

SMILES: c1cc(ccc1CN1CCOCC1)C(=O)O

Synonyms:

• 4-(Morpholin-4-Ylmethyl)Benzoic Acid

4-(Morpholinomethyl)benzoic acid

CAS: 62642-62-0

Formula: C₁₂H₁₅NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 221.2524

Ref: IN-DA003775

4-[(Morpholin-4-yl)methyl]benzoic acid

CAS: 62642-62-0

4-[(Morpholin-4-yl)methyl]benzoic acid

Purity: 98%

Color and Shape: Off-White Solid

Molecular weight: 221.25g/mol

Ref: 54-OR346277

4-Morpholin-4-ylmethyl-benzoic acid

CAS: 62642-62-0

Formula: C₁₂H₁₅NO₃

Purity: 98%

Color and Shape: Solid, White crystalline powder

Molecular weight: 221.256

Ref: 10-F057081

4-​(Morpholinomethyl)​benzoic Acid

Controlled Product

CAS: 62642-62-0

Formula: C₁₀H₈ClNO₂S

Color and Shape: Neat

Molecular weight: 241.694

Ref: TR-M725180