CAS 6265-73-2: N-(2-Hydroxyethyl)nicotinamide
Description:N-(2-Hydroxyethyl)nicotinamide, also known as 2-hydroxyethyl niacinamide, is a derivative of niacinamide (nicotinamide) that features a hydroxyethyl group. This compound is characterized by its white to off-white crystalline appearance and is soluble in water and alcohol, making it suitable for various applications in pharmaceuticals and cosmetics. It exhibits properties that can enhance skin hydration, improve barrier function, and provide anti-inflammatory effects, which makes it a popular ingredient in skincare formulations. Additionally, it may play a role in cellular metabolism and has been studied for its potential benefits in treating skin conditions such as acne and hyperpigmentation. The compound is generally considered safe for topical use, but like any chemical, it should be handled with care, following appropriate safety guidelines. Its stability and compatibility with other ingredients in formulations are also important considerations for effective use in various applications.
Formula:C8H10N2O2
InChI:InChI=1S/C8H10N2O2/c11-5-4-10-8(12)7-2-1-3-9-6-7/h1-3,6,11H,4-5H2,(H,10,12)
InChI key:InChIKey=SJZLOWYUGKIWAK-UHFFFAOYSA-N
SMILES:O=C(NCCO)C=1C=NC=CC1
- Synonyms:
- 3-(2-Hydroxyethyl)carbamoylpyridine
- 3-pyridinecarboxamide, N-(2-hydroxyethyl)-
- Hydroxyethyl nicotinamide
- N-(2-Hydroxyethyl)-3-Pyridinecarboxamide
- N-(2-hydroxyethyl)nicotinamide
- N-Nicotinoyl-2-aminoethanol
- N-Nicotinoylethanolamine
- NSC 33142
- Nicotinamide, N-(2-hydroxyethyl)-
- Sg 86
- See more synonyms
