CAS 62653-85-4
:7-epi-Jasmonic Acid
Description:
7-epi-Jasmonic Acid is a naturally occurring plant hormone belonging to the jasmonate family, which plays a crucial role in regulating various physiological processes in plants, including growth, development, and stress responses. This compound is characterized by its bicyclic structure, which includes a cyclopentane ring fused to a cyclohexene moiety, contributing to its biological activity. It is known for its involvement in plant defense mechanisms, particularly in response to herbivory and pathogen attack, by activating specific signaling pathways that lead to the expression of defense-related genes. Additionally, 7-epi-Jasmonic Acid is involved in the regulation of secondary metabolite production, which can enhance a plant's resilience and adaptability to environmental stressors. The compound is typically found in trace amounts in various plant species and can be synthesized in the laboratory for research purposes. Its applications extend to agriculture, where it is explored for its potential to improve crop resistance and yield. Overall, 7-epi-Jasmonic Acid is a significant compound in plant biochemistry with implications for both ecological interactions and agricultural practices.
Formula:C12H18O3
InChI:InChI=1S/C12H18O3/c1-2-3-4-5-10-9(8-12(14)15)6-7-11(10)13/h3-4,9-10H,2,5-8H2,1H3,(H,14,15)/b4-3-/t9-,10+/m1/s1
InChI key:InChIKey=ZNJFBWYDHIGLCU-QKMQQOOLSA-N
SMILES:C(C(O)=O)[C@@H]1[C@H](C/C=C\CC)C(=O)CC1
Synonyms:- (1R,2S)-3-Oxo-2-(2Z)-2-pentenylcyclopentaneacetic acid
- Cyclopentaneacetic acid, 3-oxo-2-(2-pentenyl)-, [1R-[1α,2α(Z)]]-
- 2-Isojasmonic acid
- Cyclopentaneacetic acid, 3-oxo-2-(2Z)-2-pentenyl-, (1R,2S)-
- 7-Isojasmonic acid
- 2-iso Jasmonic Acid
- (1R,2S)-2-[(Z)-2-Pentenyl]-3-oxocyclopentane-1-acetic acid
- (1R)-3-oxo-2S-(2Z)-2-pentenyl-cyclopentaneacetic acid
- (1R)-3-Oxo-2α-[(Z)-2-pentenyl]cyclopentane-1α-acetic acid
- epi-Jasmonic acid
- [1R,(+)]-3-Oxo-2α-[(Z)-2-pentenyl]cyclopentane-1α-acetic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(±)7-epi Jasmonic Acid
CAS:(±)-7-epiJasmonic acid, the primary metabolite in the 12-oxo phytodienoic acid pathway of 13(S)-hydroperoxy linolenic acid metabolism in plants, is synthesized initially as the more active (+)-7-epijasmonic acid. It quickly epimerizes to the more stable (−)-7-jasmonic acid isomer, demonstrating its biological relevance. Acting as a plant growth regulator, (±)-7-epiJasmonic acid triggers various signal transduction pathways, which can either promote growth or inhibit it, likely as a response to stress conditions.Formula:C12H18O3Color and Shape:SolidMolecular weight:210.2737epi Jasmonic acid
CAS:Formula:C12H18O3Purity:>98%Color and Shape:In solution, Methyl acetateMolecular weight:210.27(±)7-epiJasmonic acid
CAS:(±)7-EpiJasmonic acid is a carotenoid ester that has been found to have biological properties for weed control. It is the methyl ester of jasmonic acid, which is a fatty acid. The compound has been shown to be effective in suppressing plant diseases such as powdery mildew. The chemical transformation of (±)7-epiJasmonic acid can occur through methylation, hydroxylation, or nitro group formation. This process leads to the production of methyl jasmonate and nitrophenol. These compounds have been shown to have fertility effects on lettuce plants by increasing the number of seeds and seedlings produced.
Formula:C12H18O3Purity:Min. 95%Molecular weight:210.27 g/mol



