CAS 6266-66-6

(2R)-2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoate

Description:

The chemical substance known as (2R)-2-(1H-indol-3-yl)-4-oxo-4-phenylbutanoate, with the CAS number 6266-66-6, is a compound that features a complex structure incorporating an indole moiety and a phenyl group. It is characterized by its ester functional group, which is derived from the reaction of a carboxylic acid and an alcohol. The presence of the indole ring suggests potential biological activity, as indole derivatives are often associated with various pharmacological properties, including anti-inflammatory and anticancer effects. The compound's stereochemistry, indicated by the (2R) designation, implies that it has a specific three-dimensional arrangement that may influence its reactivity and interactions with biological targets. Additionally, the presence of the keto group (4-oxo) contributes to its reactivity and potential for forming hydrogen bonds. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features and potential biological activities.

Formula: C₁₈H₁₄NO₃

InChI: InChI=1/C18H15NO3/c20-17(12-6-2-1-3-7-12)10-14(18(21)22)15-11-19-16-9-5-4-8-13(15)16/h1-9,11,14,19H,10H2,(H,21,22)/p-1/t14-/m1/s1

SMILES: c1ccc(cc1)C(=O)C[C@H](c1c[nH]c2ccccc12)C(=O)[O-]

2-Indol-3-yl-4-oxo-4-phenylbutanoic Acid

CAS: 6266-66-6

Formula: C₁₈H₁₅NO₃

Purity: 98%

Molecular weight: 293.3166

Ref: IN-DA00EATK

PEO-IAA

CAS: 6266-66-6

PEO-IAA

Purity: ≥95%

Molecular weight: 293.32g/mol

Ref: 54-BUP11230

PEO-IAA

CAS: 6266-66-6

PEO-IAA (2-(1H-Indol-3-yl)-4-oxo-4-phenyl-butyric acid) is a novel potent auxin antagonist.

Formula: C₁₈H₁₅NO₃

Purity: 97.89% - 99.61%

Color and Shape: Solid

Molecular weight: 293.32

Ref: TM-T4603

2-Indol-3-yl-4-oxo-4-phenylbutanoic acid

CAS: 6266-66-6

2-Indol-3-yl-4-oxo-4-phenylbutanoic acid is a plant derived compound that has been shown to be effective in inhibiting the growth of pea plants. It inhibits pea nodule formation by binding to the regulatory protein 2-aminoisobutyric acid (ABA) receptor, which is necessary for transport of ABA into the cell. In addition, 2I3O4PBA has been shown to inhibit transcriptional regulation of genes involved in plant growth and development. The mechanism of action for this compound is not fully understood, but it may involve chemical biology or genetic analyses.

Formula: C₁₈H₁₅NO₃

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 293.32 g/mol

Ref: 3D-FI169521

2-Indol-3-yl-4-oxo-4-phenylbutanoic Acid

Controlled Product

CAS: 6266-66-6

Formula: C₁₈H₁₅NO₃

Color and Shape: Neat

Molecular weight: 293.317

Ref: TR-I633000