CAS 6267-24-9
:1,1′,1′′-[Methylidynetris(thio)]tris[ethane]
Description:
1,1′,1′′-[Methylidynetris(thio)]tris[ethane], with the CAS number 6267-24-9, is a chemical compound characterized by its unique structure that includes multiple thioether groups. This compound features a central methylidynetris(thio) moiety, which is connected to three ethane groups. The presence of sulfur in the thioether linkages imparts distinctive properties, such as increased stability and potential reactivity in various chemical environments. The compound is typically a colorless to pale yellow liquid or solid, depending on its specific form and purity. It may exhibit moderate to low solubility in water but is generally soluble in organic solvents. Its applications can range from use in organic synthesis to potential roles in materials science, particularly in the development of polymers or as a reagent in chemical reactions. Safety data should be consulted, as compounds containing sulfur can have specific handling and toxicity considerations. Overall, 1,1′,1′′-[Methylidynetris(thio)]tris[ethane] is an interesting compound with unique chemical properties.
Formula:C7H16S3
InChI:InChI=1S/C7H16S3/c1-4-8-7(9-5-2)10-6-3/h7H,4-6H2,1-3H3
InChI key:InChIKey=HBBOGXAEKAVLGW-UHFFFAOYSA-N
SMILES:C(SCC)(SCC)SCC
Synonyms:- 1,1′,1′′-[Methylidynetris(thio)]tris[ethane]
- Ethane, 1,1′,1′′-[methylidynetris(thio)]tris-
- Ethyl orthothioformate~Triethyl trithioorthoformate
- Ethyl orthotrithioformate
- Ethyl thioorthoformate
- NSC 37982
- Orthoformic acid, trithio-, triethyl ester
- Triethyl orthothioformate
- Triethyl trithioorthoformate
- {[Bis(Ethylsulfanyl)Methyl]Sulfanyl}Ethane
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tris(ethylthio)methane
CAS:Tris(ethylthio)methane (TETM) is an antibacterial agent that is a chloride derivative of ethyl formate. It has the ability to cleave peptide bonds, producing amino acid fragments. TETM is a nucleophile and reacts with 7-aminocephalosporanic acid to produce methylsulfide and methyl alcohol. The inhibition constant for TETM against bacteria is 2.0×10 M. The bond cleavage reactions are a result of the electronic interaction between the methylene group (-CH2-) and the sulfur atom in the thiomethyl group (-S-CH3). This reaction is reversible, meaning that TETM can be reduced back to its original form by reducing agents such as sodium borohydride or sodium dithionite.Formula:C7H16S3Purity:Min. 95%Molecular weight:196.4 g/mol

