CymitQuimica logo

CAS 6268-04-8

:

3-[ethyl(4-sulfobenzyl)amino]benzenesulfonic acid

Description:
3-[Ethyl(4-sulfobenzyl)amino]benzenesulfonic acid, with the CAS number 6268-04-8, is an organic compound characterized by its sulfonic acid functional group, which imparts strong acidity and solubility in water. This compound features an ethyl group attached to a nitrogen atom, which is further connected to a 4-sulfobenzyl moiety, contributing to its overall polarity and potential for ionic interactions. The presence of multiple aromatic rings enhances its stability and may influence its electronic properties, making it useful in various applications, including as a dye or in biochemical assays. Its sulfonic acid group can participate in hydrogen bonding and ionic interactions, which may affect its behavior in biological systems. Additionally, the compound's structure suggests potential for use in pharmaceuticals or as a reagent in organic synthesis. Overall, 3-[ethyl(4-sulfobenzyl)amino]benzenesulfonic acid is notable for its solubility, acidity, and potential utility in diverse chemical and biological contexts.
Formula:C15H17NO6S2
InChI:InChI=1/C15H17NO6S2/c1-2-16(13-4-3-5-15(10-13)24(20,21)22)11-12-6-8-14(9-7-12)23(17,18)19/h3-10H,2,11H2,1H3,(H,17,18,19)(H,20,21,22)
SMILES:CCN(Cc1ccc(cc1)S(=O)(=O)O)c1cccc(c1)S(=O)(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.