CAS 6269-33-6
:3-(4-Chlorobenzoyl)acrylic acid
Description:
3-(4-Chlorobenzoyl)acrylic acid, with the CAS number 6269-33-6, is an organic compound characterized by its structure, which features an acrylic acid moiety substituted with a 4-chlorobenzoyl group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the chlorobenzoyl group enhances its reactivity and may influence its solubility and stability in different solvents. As an acrylic acid derivative, it possesses functional groups that can participate in various chemical reactions, such as polymerization or esterification. The chlorinated aromatic ring can also impart unique electronic properties, making it useful in the synthesis of more complex molecules. Additionally, the compound may exhibit biological activity, which could be of interest for medicinal chemistry. Safety data should be consulted to understand its handling and toxicity, as with any chemical substance.
Formula:C10H7ClO3
InChI:InChI=1/C10H7ClO3/c11-8-3-1-7(2-4-8)9(12)5-6-10(13)14/h1-6H,(H,13,14)/b6-5+
Synonyms:- (2E)-4-(4-chlorophenyl)-4-oxobut-2-enoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-(4-Chlorobenzoyl)acrylic acid, 99%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C10H7ClO3Purity:99%Color and Shape:Yellow, Crystals or powder or crystalline powderMolecular weight:210.612-Butenoic acid, 4-(4-chlorophenyl)-4-oxo-
CAS:Formula:C10H7ClO3Purity:99%Color and Shape:SolidMolecular weight:210.6138(2E)-4-(4-Chlorophenyl)-4-oxobut-2-enoic acid
CAS:(2E)-4-(4-Chlorophenyl)-4-oxobut-2-enoic acidPurity:95%Molecular weight:210.61g/mol



