CAS 6269-44-9: 3-(1,3-benzothiazol-2-yl)butan-2-one

Description: 3-(1,3-benzothiazol-2-yl)butan-2-one, with the CAS number 6269-44-9, is an organic compound characterized by its unique structure that includes a benzothiazole moiety and a ketone functional group. This compound typically appears as a solid or crystalline substance and is known for its potential applications in various fields, including pharmaceuticals and materials science. The presence of the benzothiazole ring contributes to its biological activity, making it of interest in medicinal chemistry for potential antimicrobial or anticancer properties. Additionally, the butan-2-one part of the molecule indicates that it has a carbonyl group, which can participate in various chemical reactions, such as nucleophilic additions. Its solubility characteristics may vary depending on the solvent, and it is generally stable under standard conditions. However, like many organic compounds, it should be handled with care, considering safety protocols related to chemical exposure. Overall, this compound exemplifies the intersection of organic chemistry and potential therapeutic applications.

Formula: C₁₁H₁₁NOS

InChI: InChI=1/C11H11NOS/c1-7(8(2)13)11-12-9-5-3-4-6-10(9)14-11/h3-7H,1-2H3

3-(1,3-Benzothiazol-2-yl)butan-2-one

CAS: 6269-44-9

Versatile small molecule scaffold

• Formula: C₁₁H₁₁NOS
• Purity: Min. 95%
• Molecular weight: 205.28 g/mol

3-(1,3-Benzothiazol-2-yl)butan-2-one

CAS: 6269-44-9

• Purity: 95%
• Molecular weight: 205.27999877929688