CAS 6270-08-2

4-Chloro-2,6-dimethylquinoline

Description:

4-Chloro-2,6-dimethylquinoline is an organic compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 4-position and two methyl groups at the 2 and 6 positions of the quinoline ring. It is typically a yellow to brown solid at room temperature and is sparingly soluble in water but more soluble in organic solvents such as ethanol and acetone. The presence of the chlorine and methyl substituents influences its chemical reactivity and physical properties, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. 4-Chloro-2,6-dimethylquinoline may exhibit biological activity, and its derivatives are often studied for potential antimicrobial or antitumor properties. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.

Formula: C₁₁H₁₀ClN

InChI: InChI=1/C11H10ClN/c1-7-3-4-11-9(5-7)10(12)6-8(2)13-11/h3-6H,1-2H3

SMILES: Cc1ccc2c(c1)c(cc(C)n2)Cl

4-Chloro-2,6-dimethylquinoline

CAS: 6270-08-2

Formula: C₁₁H₁₀ClN

Purity: 98%

Color and Shape: Solid

Molecular weight: 191.6568

Ref: IN-DA00EA2T

4-Chloro-2,6-dimethylquinoline

CAS: 6270-08-2

4-Chloro-2,6-dimethylquinoline

Purity: ≥95%

Color and Shape: Powder

Molecular weight: 191.66g/mol

Ref: 54-OR3632