CAS 6270-23-1

(2-methoxy-4-methylphenoxy)acetate

Description:

(2-Methoxy-4-methylphenoxy)acetate, with the CAS number 6270-23-1, is an organic compound characterized by its aromatic structure and ether functionality. It features a methoxy group (-OCH3) and a methyl group (-CH3) attached to a phenyl ring, contributing to its hydrophobic properties. The acetate moiety indicates the presence of an ester functional group, which typically enhances solubility in organic solvents. This compound is likely to exhibit moderate volatility and may have a low to moderate boiling point due to its molecular structure. Its chemical behavior can be influenced by the presence of the methoxy and methyl substituents, which can affect reactivity and interaction with other substances. Additionally, (2-methoxy-4-methylphenoxy)acetate may have applications in various fields, including pharmaceuticals and agrochemicals, owing to its potential biological activity. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₁O₄

InChI: InChI=1/C10H12O4/c1-7-3-4-8(9(5-7)13-2)14-6-10(11)12/h3-5H,6H2,1-2H3,(H,11,12)/p-1

SMILES: Cc1ccc(c(c1)OC)OCC(=O)O

Synonyms:

• Acetic acid, 2-(2-methoxy-4-methylphenoxy)-

2-(2-Methoxy-4-methylphenoxy)acetic acid

CAS: 6270-23-1

Formula: C₁₀H₁₂O₄

Molecular weight: 196.1999

Ref: IN-DA00EJAB

2-(2-Methoxy-4-methylphenoxy)acetic acid

CAS: 6270-23-1

Purity: 95+%

Molecular weight: 196.2019958

Ref: 10-F643045

(2-Methoxy-4-methyl-phenoxy)-acetic acid

CAS: 6270-23-1

Versatile small molecule scaffold

Formula: C₁₀H₁₂O₄

Purity: Min. 95%

Molecular weight: 196.2 g/mol

Ref: 3D-GAA27023