CAS 6270-47-9
:phenyl(pyridin-3-yl)methanol
Description:
Phenyl(pyridin-3-yl)methanol, with the CAS number 6270-47-9, is an organic compound characterized by the presence of a phenyl group and a pyridine ring attached to a methanol moiety. This compound features a hydroxymethyl group (-CH2OH) linked to a pyridine nitrogen at the 3-position, which contributes to its unique chemical properties. It is typically a white to off-white solid at room temperature and is soluble in polar organic solvents due to the hydroxyl group. The presence of both aromatic and heterocyclic structures in its molecular framework allows for potential interactions in various chemical reactions, including hydrogen bonding and electrophilic aromatic substitution. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks often exhibit biological activity. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the pyridine and phenyl groups, making it a subject of interest in synthetic organic chemistry.
Formula:C12H11NO
InChI:InChI=1/C12H11NO/c14-12(10-5-2-1-3-6-10)11-7-4-8-13-9-11/h1-9,12,14H
SMILES:c1ccc(cc1)C(c1cccnc1)O
Synonyms:- alpha-Phenyl-3-pyridinemethanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Phenyl(pyridin-3-yl)methanol
CAS:Phenyl(pyridin-3-yl)methanol is an organic compound that can be used as a chemical reagent. It reacts with alcohols to form phenols and has been shown to selectively react with heteroarenes and amino groups. Phenyl(pyridin-3-yl)methanol is able to oxidize cyclic, aromatic, and diamino compounds using oxidants such as hydrogen peroxide or sodium hypochlorite. It has also been shown to be catalyzed by palladium in the oxidation of amines.Formula:C12H11NOPurity:Min. 95%Molecular weight:185.23 g/mol

