
CAS 62708-52-5
:4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, compd. with zinc chloride (ZnCl2) (2:1)
Description:
4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, complexed with zinc chloride (ZnCl2), is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound typically exhibits properties associated with both the imidazole moiety and the zinc chloride complex. The presence of the amino group contributes to its potential as a ligand, allowing it to form coordination complexes with metal ions like zinc. The zinc chloride acts as a Lewis acid, enhancing the reactivity of the imidazole derivative. This compound may exhibit biological activity, potentially serving as a catalyst or in medicinal chemistry applications due to its structural features. Additionally, it may display solubility in polar solvents, influenced by the presence of the zinc chloride. Overall, the combination of the imidazole structure and zinc chloride provides unique chemical properties that can be exploited in various chemical and biological contexts.
Formula:C4H7N3OCl2Zn
InChI:InChI=1S/C4H7N3O.2ClH.Zn/c1-7-2-3(8)6-4(7)5;;;/h2H2,1H3,(H2,5,6,8);2*1H;/q;;;+2/p-2
InChI key:InChIKey=FSTJUYRQYIWLSX-UHFFFAOYSA-L
SMILES:[Zn](Cl)Cl.NC=1N(C)CC(=O)N1
Synonyms:- Zinc chloride, compd. with 2-amino-1,5-dihydro-1-methyl-4H-imidazol-4-one (1:2)
- 4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, compd. with zinc chloride (2:1)
- 4H-Imidazol-4-one, 2-amino-1,5-dihydro-1-methyl-, compd. with zinc chloride (ZnCl2) (2:1)
- Zinc chloride (ZnCl2), compd. with 2-amino-1,5-dihydro-1-methyl-4H-imidazol-4-one (1:2)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Creatinine zinc chloride
CAS:Creatinine zinc chloride is a fine chemical that is useful as a scaffold for the synthesis of complex compounds. Creatinine zinc chloride has been used as an intermediate in the synthesis of research chemicals and as a reaction component in the production of speciality chemicals. It has also been used as a building block for the synthesis of high-quality reagents.
Formula:(C4H7N3O)2•ZnCl2Purity:Min. 95%Color and Shape:PowderMolecular weight:362.52 g/molCreatinine Zinc Chloride
CAS:Controlled ProductApplications Creatinine zinc chloride (cas# 62708-52-5) is a useful research chemical.
Formula:C4H7N3O·Zn·2ClColor and Shape:White To Off-WhiteMolecular weight:362.55

