CymitQuimica logo

CAS 6271-30-3

:

propan-2-yl hydrazinecarboxylate

Description:
Propan-2-yl hydrazinecarboxylate, also known by its CAS number 6271-30-3, is an organic compound characterized by the presence of both hydrazine and carboxylate functional groups. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. This compound is known for its potential applications in organic synthesis, particularly in the preparation of various nitrogen-containing compounds. Its structure features a propan-2-yl group, which contributes to its hydrophobic characteristics, while the hydrazine moiety provides reactivity that can be exploited in various chemical reactions, such as condensation and coupling reactions. The carboxylate group enhances its solubility in polar solvents, making it versatile in different chemical environments. Safety considerations are important, as hydrazine derivatives can be toxic and potentially hazardous, necessitating proper handling and storage protocols. Overall, propan-2-yl hydrazinecarboxylate is a valuable compound in the field of synthetic organic chemistry.
Formula:C4H10N2O2
InChI:InChI=1/C4H10N2O2/c1-3(2)8-4(7)6-5/h3H,5H2,1-2H3,(H,6,7)
InChI key:PHHLRHSOQWTNBH-UHFFFAOYSA-N
SMILES:CC(C)OC(=NN)O
Found 3 products.