CAS 62718-31-4

1-benzylpiperidine-4-carbonitrile

Description:

1-Benzylpiperidine-4-carbonitrile is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The compound features a benzyl group attached to the nitrogen atom of the piperidine, along with a cyano group (-C≡N) at the 4-position of the piperidine ring. This configuration contributes to its unique chemical properties, including its potential as a building block in organic synthesis and medicinal chemistry. The presence of the cyano group enhances its reactivity, making it useful in various chemical reactions, such as nucleophilic additions and substitutions. Additionally, the compound may exhibit biological activity, which has led to interest in its pharmacological applications. Its molecular structure allows for interactions with biological targets, potentially influencing its efficacy in therapeutic contexts. As with many organic compounds, safety and handling precautions should be observed due to its chemical nature.

Formula: C₁₃H₁₆N₂

InChI: InChI=1/C13H16N2/c14-10-12-6-8-15(9-7-12)11-13-4-2-1-3-5-13/h1-5,12H,6-9,11H2

SMILES: c1ccc(cc1)CN1CCC(CC1)C#N

Synonyms:

• 1-Benzyl-piperidine-4-carbonitrile
• 4-Piperidinecarbonitrile, 1-(phenylmethyl)-
• 1-Benzyl-4-cyanopiperidine

1-Benzylpiperidine-4-carbonitrile

CAS: 62718-31-4

Formula: C₁₃H₁₆N₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 200.2795

Ref: IN-DA00EFDB

1-Benzylpiperidine-4-carbonitrile

CAS: 62718-31-4

1-Benzylpiperidine-4-carbonitrile

Purity: 97%

Molecular weight: 200.28g/mol

Ref: 54-OR96087

1-Benzylpiperidine-4-carbonitrile

CAS: 62718-31-4

Formula: C₁₃H₁₆N₂

Purity: 96%

Color and Shape: Liquid

Molecular weight: 200.285

Ref: 10-F077999