CymitQuimica logo

CAS 6272-40-8

:

Methanone,2-benzofuranylphenyl-

Description:
Methanone, 2-benzofuranylphenyl- (CAS 6272-40-8) is an organic compound characterized by its unique structure, which includes a benzofuran moiety and a phenyl group attached to a carbonyl (ketone) functional group. This compound typically exhibits properties associated with aromatic compounds, such as stability and potential for various chemical reactions, including electrophilic substitution. The presence of the benzofuran ring suggests that it may possess interesting biological activities, as many benzofuran derivatives are known for their pharmacological properties. Additionally, the compound's molecular structure may influence its solubility, melting point, and reactivity, making it relevant in fields such as medicinal chemistry and materials science. Its specific applications and behavior in chemical reactions would depend on the functional groups present and the overall molecular configuration. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C15H10O2
InChI:InChI=1S/C15H10O2/c16-15(11-6-2-1-3-7-11)14-10-12-8-4-5-9-13(12)17-14/h1-10H
InChI key:DZRJNLPOTUVETG-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(=O)C2=CC3=CC=CC=C3O2
Synonyms:
  • Ketone,2-benzofuranyl phenyl (7CI,8CI)
  • 2-Benzofuranyl phenyl ketone
  • 2-Benzoylbenzofuran
  • Nsc 37429
Found 5 products.