CAS 6272-50-0

(1E)-2,3,4,5-tetrahydroxypentanal oxime (non-preferred name)

Description:

(1E)-2,3,4,5-tetrahydroxypentanal oxime, with the CAS number 6272-50-0, is an organic compound characterized by its oxime functional group, which is formed by the reaction of an aldehyde with hydroxylamine. This compound features a pentanal backbone, indicating it has a five-carbon chain with an aldehyde group at one end. The presence of four hydroxyl (-OH) groups suggests it is a polyol, contributing to its potential solubility in water and its ability to form hydrogen bonds. The stereochemistry indicated by the "(1E)" designation suggests a specific geometric configuration around the double bond, which can influence the compound's reactivity and interactions. Such compounds may exhibit biological activity and can be of interest in various fields, including medicinal chemistry and biochemistry. However, detailed information regarding its specific applications, toxicity, and stability may require further investigation, as it is not widely studied compared to more common compounds.

Formula: C₅H₁₁NO₅

InChI: InChI=1/C5H11NO5/c7-2-4(9)5(10)3(8)1-6-11/h1,3-5,7-11H,2H2/b6-1+