CAS 6273-59-2

2-(benzylamino)-2-phenylethanol

Description:

2-(Benzylamino)-2-phenylethanol, with the CAS number 6273-59-2, is an organic compound characterized by its structure, which features a central carbon atom bonded to a hydroxyl group, a benzylamino group, and a phenyl group. This compound typically appears as a white to off-white solid and is soluble in organic solvents, reflecting its hydrophobic characteristics due to the presence of aromatic rings. It exhibits both alcohol and amine functional groups, which contribute to its potential reactivity and ability to form hydrogen bonds. The presence of the benzylamino moiety suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its properties, such as melting point, boiling point, and specific reactivity, can vary based on purity and environmental conditions, and it should be handled with appropriate safety precautions due to the potential for toxicity associated with amine-containing compounds.

Formula: C₁₅H₁₇NO

InChI: InChI=1/C15H17NO/c17-12-15(14-9-5-2-6-10-14)16-11-13-7-3-1-4-8-13/h1-10,15-17H,11-12H2

SMILES: c1ccc(cc1)CNC(CO)c1ccccc1

2-(Benzylamino)-2-phenylethanol

CAS: 6273-59-2

Versatile small molecule scaffold

Formula: C₁₅H₁₇NO

Purity: Min. 95%

Molecular weight: 227.3 g/mol

Ref: 3D-GAA27359