CAS 62732-91-6
:2-(2-ethoxyethoxy)ethyl 1H-benzimidazol-2-ylcarbamate
Description:
2-(2-Ethoxyethoxy)ethyl 1H-benzimidazol-2-ylcarbamate, with the CAS number 62732-91-6, is a chemical compound characterized by its complex structure, which includes a benzimidazole moiety linked to a carbamate group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in pharmaceutical and agricultural applications. The presence of the ethoxyethoxy group suggests that it may have enhanced solubility and stability, which can influence its interaction with biological systems. Additionally, compounds of this nature often display a range of biological activities, including antifungal or antibacterial properties, depending on their specific structural features. The benzimidazole core is known for its role in various medicinal applications, contributing to the compound's potential efficacy. Overall, the characteristics of this compound make it a subject of interest for further research in medicinal chemistry and related fields.
Formula:C14H19N3O4
InChI:InChI=1/C14H19N3O4/c1-2-19-7-8-20-9-10-21-14(18)17-13-15-11-5-3-4-6-12(11)16-13/h3-6H,2,7-10H2,1H3,(H2,15,16,17,18)
InChI key:InChIKey=DNBMPXLFKQCOBV-UHFFFAOYSA-N
SMILES:N(C(OCCOCCOCC)=O)C=1NC=2C(N1)=CC=CC2
Synonyms:- 1H-Benzimidazol-2-yl-carbamic acid 2-(2-ethoxyethoxy)ethyl ester
- 1H-Benzimidazol-2-ylcarbamate de 2-(2-éthoxyéthoxy)éthyle
- 2-(2-Ethoxyethoxy)ethyl benzimidazol-2-ylcarbamate
- 2-(2-Ethoxyethoxy)ethyl-1H-benzimidazol-2-ylcarbamat
- 62732-91-6
- Carbamic acid, 1H-benzimidazol-2-yl-, 2-(2-ethoxyethoxy)ethyl ester
- Carbamic acid, N-1H-benzimidazol-2-yl-, 2-(2-ethoxyethoxy)ethyl ester
- Debacarb
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Debacarb
CAS:Controlled Product<p>Applications Debacarb (CAS# 62732-91-6) is a useful research chemical compound.<br></p>Formula:C14H19N3O4Color and Shape:NeatMolecular weight:293.32Debacarb
CAS:<p>Debacarb is a subtilis mutant strain that produces the active substances debacarb and debacin. Debacarb inhibits the mitochondrial cytochrome b-245, which is an enzyme in the electron transport chain of mitochondria. It also inhibits bacterial growth by binding to nicotinic acetylcholine, which is an enzyme involved in the synthesis of bacterial cell walls. The target enzymes for this compound are not yet known. The bacterium Agrobacterium tumefaciens was found to be sensitive to Debacarb, but resistant strains were also obtained. Debacarb has been used as an agrochemical against bacterial strains such as Pseudomonas syringae and Erwinia carotovora. The effective dose for Debacarb varies depending on the bacterial strain. The most common effective doses are between 2 and 5 ppm, but higher concentrations may be needed against some bacteria.br> Debacarb can inhibit polymerase chain reactions, which</p>Formula:C14H19N3O4Purity:Min. 95%Molecular weight:293.32 g/mol


