CAS 6274-18-6

3-amino-N,N-dimethylbenzenesulfonamide

Description:

3-Amino-N,N-dimethylbenzenesulfonamide, also known as a sulfonamide compound, is characterized by the presence of an amino group and a sulfonamide functional group attached to a dimethyl-substituted benzene ring. This compound typically exhibits properties such as being a white to off-white crystalline solid, which is soluble in polar solvents like water and alcohols due to the sulfonamide group. It has applications in medicinal chemistry, particularly in the development of antibacterial agents, as sulfonamides are known for their antimicrobial properties. The presence of the amino group can also enhance its reactivity and potential for forming various derivatives. In terms of safety, like many sulfonamides, it may cause allergic reactions in sensitive individuals, and proper handling precautions should be observed. Overall, 3-amino-N,N-dimethylbenzenesulfonamide is a versatile compound with significant relevance in pharmaceutical research and development.

Formula: C₈H₁₂N₂O₂S

InChI: InChI=1/C8H12N2O2S/c1-10(2)13(11,12)8-5-3-4-7(9)6-8/h3-6H,9H2,1-2H3

SMILES: CN(C)S(=O)(=O)c1cccc(c1)N

Synonyms:

• Benzenesulfonamide, 3-amino-N,N-dimethyl-

3-Amino-N,N-dimethylbenzenesulfonamide

CAS: 6274-18-6

Formula: C₈H₁₂N₂O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.2581

Ref: IN-DA003IXT

3-Amino-N,N-dimethylbenzenesulfonamide

CAS: 6274-18-6

3-Amino-N,N-dimethylbenzenesulfonamide

Purity: 98%

Molecular weight: 200.26g/mol

Ref: 54-OR75583

3-Amino-N,N-dimethylbenzenesulfonamide

CAS: 6274-18-6

Formula: C₈H₁₂N₂O₂S

Purity: 98%

Molecular weight: 200.26

Ref: 10-F446585

3-Amino-N,N-dimethyl-benzenesulfonamide

CAS: 6274-18-6

Versatile small molecule scaffold

Formula: C₈H₁₂N₂O₂S

Purity: Min. 95%

Molecular weight: 200.26 g/mol

Ref: 3D-GAA27418