CAS 6274-82-4

2,6-dimethoxypyridine-4-carboxylic acid

Description:

2,6-Dimethoxypyridine-4-carboxylic acid is an organic compound characterized by its pyridine ring, which is substituted at the 2 and 6 positions with methoxy groups and at the 4 position with a carboxylic acid group. This compound typically appears as a solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group, which can engage in hydrogen bonding. The methoxy groups contribute to its overall polarity and can influence its reactivity and interaction with other molecules. As a pyridine derivative, it may exhibit biological activity, making it of interest in pharmaceutical research. The presence of both electron-donating (methoxy) and electron-withdrawing (carboxylic acid) groups can affect its acidity and basicity, as well as its potential as a ligand in coordination chemistry. Additionally, it may serve as an intermediate in organic synthesis or as a building block for more complex molecules. Overall, 2,6-dimethoxypyridine-4-carboxylic acid is a versatile compound with various applications in chemical research and industry.

Formula: C₈H₉NO₄

InChI: InChI=1/C8H9NO4/c1-12-6-3-5(8(10)11)4-7(9-6)13-2/h3-4H,1-2H3,(H,10,11)

SMILES: COc1cc(cc(n1)OC)C(=O)O

2,6-Dimethoxyisonicotinic acid

CAS: 6274-82-4

Formula: C₈H₉NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.1614

Ref: IN-DA0035XJ

2,6-Dimethoxyisonicotinic acid

CAS: 6274-82-4

2,6-Dimethoxyisonicotinic acid

Purity: 95%

Molecular weight: 183.16g/mol

Ref: 54-OR76329

2,6-Dimethoxyisonicotinic acid

CAS: 6274-82-4

Formula: C₈H₉NO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 183.163

Ref: 10-F232645

2,6-Dimethoxyisonicotinic acid

CAS: 6274-82-4

2,6-Dimethoxyisonicotinic acid is a cytotoxic agent that is structurally related to colchicine and combretastatin A-4. It has been shown to induce apoptosis in cancer cells by inhibiting the polymerization of tubulin. This drug also inhibits the proliferation of cancer cells by binding to DNA and disrupting the synthesis of proteins necessary for cell division. The inhibitory effect on protein synthesis may be due to its ability to inhibit the activity of RNA polymerase II and III, which are essential for transcription. 2,6-Dimethoxyisonicotinic acid also induces an anticancer effect through its ability to bind to phenolic moieties and inhibit the growth of cancer cells.

Formula: C₈H₉NO₄

Purity: Min. 95%

Molecular weight: 183.16 g/mol

Ref: 3D-GAA27482