CAS 62740-68-5
:4,4,5,5-tetradeuterioimidazolidin-2-one
Description:
4,4,5,5-Tetradeuterioimidazolidin-2-one is a deuterated derivative of imidazolidin-2-one, a five-membered heterocyclic compound featuring both nitrogen and carbon atoms. The presence of deuterium, a stable isotope of hydrogen, in the 4 and 5 positions of the imidazolidinone ring enhances its utility in various scientific applications, particularly in NMR spectroscopy and kinetic studies, where isotopic labeling can provide insights into molecular dynamics and reaction mechanisms. This compound is characterized by its relatively stable structure, which includes a carbonyl group and two nitrogen atoms within the ring, contributing to its potential as a building block in organic synthesis and medicinal chemistry. Its unique isotopic composition can also influence its physical properties, such as boiling and melting points, compared to its non-deuterated counterparts. Overall, 4,4,5,5-tetradeuterioimidazolidin-2-one serves as a valuable tool in research settings, particularly in studies involving isotopic effects and molecular interactions.
Formula:C3H2D4N2O
InChI:InChI=1/C3H6N2O/c6-3-4-1-2-5-3/h1-2H2,(H2,4,5,6)/i1D2,2D2
SMILES:C1(C(NC(=N1)O)([2H])[2H])([2H])[2H]
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Ethylene Urea-d4
CAS:Controlled Product<p>Applications Ethylene Urea-d4 (cas# 62740-68-5) is a compound useful in organic synthesis.<br></p>Formula:C32H4H2N2OColor and Shape:NeatMolecular weight:90.12
