CAS 62744-13-2

[2-benzyloxy-5-[2-[2-(4-benzyloxy-3-methoxy-phenyl)ethylamino]-2-oxo-ethyl]phenyl] ethyl carbonate

Description:

The chemical substance known as [2-benzyloxy-5-[2-[2-(4-benzyloxy-3-methoxy-phenyl)ethylamino]-2-oxo-ethyl]phenyl] ethyl carbonate, with the CAS number 62744-13-2, is a complex organic compound characterized by its multi-functional structure. It features a carbonate group, which is indicative of its potential reactivity and ability to form esters. The presence of benzyloxy and methoxy groups suggests that the compound may exhibit significant lipophilicity, potentially influencing its solubility and biological activity. The ethylamino moiety implies that it may interact with biological systems, possibly serving as a pharmacophore in medicinal chemistry. Additionally, the compound's structure suggests it may have applications in drug development or as a synthetic intermediate due to its diverse functional groups. Its stability, reactivity, and potential interactions with biological targets would depend on the specific conditions under which it is used, including pH, temperature, and the presence of other reactive species. Further studies would be necessary to elucidate its full chemical behavior and potential applications.

Formula: C₃₄H₃₅NO₇

InChI: InChI=1/C34H35NO7/c1-3-39-34(37)42-32-21-28(15-17-30(32)41-24-27-12-8-5-9-13-27)22-33(36)35-19-18-25-14-16-29(31(20-25)38-2)40-23-26-10-6-4-7-11-26/h4-17,20-21H,3,18-19,22-24H2,1-2H3,(H,35,36)

SMILES: CCOC(=O)Oc1cc(ccc1OCc1ccccc1)CC(=NCCc1ccc(c(c1)OC)OCc1ccccc1)O