CAS 627466-98-2
:2,3,4,6-Tetra-O-benzoyl-D-mannopyranose
Description:
2,3,4,6-Tetra-O-benzoyl-D-mannopyranose is a derivative of D-mannose, a naturally occurring sugar. This compound is characterized by the presence of four benzoyl groups attached to the hydroxyl positions at carbons 2, 3, 4, and 6 of the mannopyranose ring. The benzoyl groups enhance the lipophilicity and stability of the molecule, making it useful in various synthetic applications, particularly in carbohydrate chemistry. The presence of these protective groups allows for selective reactions at other functional sites, facilitating the synthesis of more complex carbohydrate structures. This compound is typically white to off-white in appearance and is soluble in organic solvents such as dichloromethane and ethyl acetate, but less soluble in water due to its hydrophobic nature. Its molecular structure contributes to its utility in organic synthesis, particularly in the preparation of glycosides and other carbohydrate derivatives. As with many chemical substances, handling should be done with care, following appropriate safety protocols.
Formula:C34H28O10
InChI:InChI=1/C34H28O10/c35-30(22-13-5-1-6-14-22)40-21-26-27(42-31(36)23-15-7-2-8-16-23)28(43-32(37)24-17-9-3-10-18-24)29(34(39)41-26)44-33(38)25-19-11-4-12-20-25/h1-20,26-29,34,39H,21H2/t26-,27-,28+,29+,34?/m1/s1
Synonyms:- D-mannopyranose, 2,3,4,6-tetrabenzoate
- 2,3,4,6-tetrakis-O-(phenylcarbonyl)-D-mannopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3,4,6-Tetra-O-benzoyl-D-mannopyranose
CAS:Controlled Product<p>Applications 2,3,4,6-Tetra-O-benzoyl-D-mannopyranose (cas# 627466-98-2) is a compound useful in organic synthesis.<br></p>Formula:C34H28O10Color and Shape:NeatMolecular weight:596.582,3,4,6-Tetra-O-benzoyl-D-mannopyranose
CAS:<p>2,3,4,6-Tetra-O-benzoyl-D-mannopyranose is a methylated saccharide with a molecular weight of 596. It is easily modified and can be used in the synthesis of complex carbohydrates. This product has been synthesized by Click chemistry and it is fluorinated. The purity of this product is >99%. CAS No. 627466-98-2.</p>Formula:C34H28O10Purity:Min. 95%Color and Shape:PowderMolecular weight:596.58 g/mol


