CAS 627470-09-1

4-(hydrazinocarbonyl)-N-methyl-1H-imidazole-5-carboxamide

Description:

4-(Hydrazinocarbonyl)-N-methyl-1H-imidazole-5-carboxamide, with the CAS number 627470-09-1, is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a hydrazinocarbonyl group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the N-methyl group indicates that it has a methyl substituent on the nitrogen atom, which can influence its solubility and biological activity. The carboxamide functional group enhances its ability to form hydrogen bonds, potentially affecting its interactions with biological targets. This compound may exhibit properties such as antimicrobial or anticancer activity, making it of interest in pharmaceutical research. Its specific characteristics, including solubility, stability, and reactivity, would depend on the conditions under which it is studied, such as pH and temperature. Overall, this compound represents a unique structure that could be explored for various chemical and biological applications.

Formula: C₆H₉N₅O₂

InChI: InChI=1/C6H9N5O2/c1-8-5(12)3-4(6(13)11-7)10-2-9-3/h2H,7H2,1H3,(H,8,12)(H,9,10)(H,11,13)

SMILES: CN=C(c1c(C(=NN)O)[nH]cn1)O

5-(Hydrazinocarbonyl)-N-methyl-1H-imidazole-4-carboxamide

CAS: 627470-09-1

Formula: C₆H₉N₅O₂

Purity: 95.0%

Molecular weight: 183.171

Ref: 10-F061235