CAS 627484-44-0

3-Chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide

Description:

3-Chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide, with the CAS number 627484-44-0, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, a cyano group, and a trifluoromethyl group attached to a phenyl ring. This compound features a hydroxyl group and an amide functional group, contributing to its potential solubility in polar solvents. The presence of the trifluoromethyl group often enhances the lipophilicity and biological activity of the molecule, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological activities. Additionally, the presence of multiple functional groups indicates that it may participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Safety and handling precautions should be observed due to the presence of chlorine and fluorine atoms, which can impart toxicity and environmental concerns.

Formula: C₁₂H₁₀ClF₃N₂O₂

InChI: InChI=1S/C12H10ClF3N2O2/c1-11(20,6-13)10(19)18-8-3-2-7(5-17)9(4-8)12(14,15)16/h2-4,20H,6H2,1H3,(H,18,19)

InChI key: InChIKey=SESZJEZURRRLMD-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C(C#N)C=CC(NC(C(CCl)(C)O)=O)=C1

Synonyms:

• Propanamide, 3-chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methyl-
• 3-Chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide

3-Chloro-N-[4-cyano-3-(trifluoromethyl)phenyl]-2-hydroxy-2-methylpropanamide

CAS: 627484-44-0

Color and Shape: Neat

Ref: 86-MM0894.32