CAS 6275-72-5

ethyl (3-nitrophenyl)carbamate

Description:

Ethyl (3-nitrophenyl)carbamate, with the CAS number 6275-72-5, is an organic compound characterized by its carbamate functional group attached to an ethyl group and a 3-nitrophenyl moiety. This compound typically appears as a solid or crystalline substance and is known for its moderate solubility in organic solvents, while being less soluble in water. The presence of the nitro group contributes to its polar nature, influencing its reactivity and interactions with other chemical species. Ethyl (3-nitrophenyl)carbamate may exhibit biological activity, making it of interest in various fields, including medicinal chemistry and agrochemicals. Its synthesis generally involves the reaction of 3-nitrophenol with ethyl chloroformate in the presence of a base. As with many nitro-substituted compounds, it may pose certain hazards, including potential toxicity, and should be handled with appropriate safety precautions. Overall, this compound serves as a valuable intermediate in organic synthesis and research applications.

Formula: C₉H₁₀N₂O₄

InChI: InChI=1/C9H10N2O4/c1-2-15-9(12)10-7-4-3-5-8(6-7)11(13)14/h3-6H,2H2,1H3,(H,10,12)

SMILES: CCOC(=Nc1cccc(c1)N(=O)=O)O

Synonyms:

• carbamic acid, N-(3-nitrophenyl)-, ethyl ester