CAS 6275-82-7

4-[(cyanomethyl)amino]benzoic acid

Description:

4-[(Cyanomethyl)amino]benzoic acid, with the CAS number 6275-82-7, is an organic compound characterized by its aromatic structure and functional groups. It features a benzoic acid moiety, which includes a carboxylic acid (-COOH) group, and a cyanomethylamino group (-CH2C≡N) attached to the para position of the benzene ring. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid group. Its chemical properties are influenced by the electron-withdrawing nature of the cyano group, which can affect reactivity and acidity. The compound may exhibit biological activity, making it of interest in pharmaceutical and chemical research. Additionally, it can participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, due to the presence of both the amino and carboxylic acid functionalities. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₈N₂O₂

InChI: InChI=1/C9H8N2O2/c10-5-6-11-8-3-1-7(2-4-8)9(12)13/h1-4,11H,6H2,(H,12,13)

SMILES: c1cc(ccc1C(=O)O)NCC#N

4-(CYANOMETHYLAMINO)BENZOIC ACID

CAS: 6275-82-7

Formula: C₉H₈N₂O₂

Purity: 95.0%

Molecular weight: 176.175

Ref: 10-F306392