CAS 62752-06-1
:6-Chloro-N2,N4-bis(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine
Description:
6-Chloro-N2,N4-bis(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine is a chemical compound characterized by its triazine core, which is a six-membered heterocyclic ring containing three nitrogen atoms. This compound features two methoxyphenyl substituents at the N2 and N4 positions, contributing to its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of a chlorine atom at the 6-position enhances its reactivity and may influence its biological activity. The triazine structure is known for its stability and ability to participate in various chemical reactions, making it a versatile scaffold in organic synthesis. Additionally, the compound's amine functional groups can engage in hydrogen bonding, which may affect its solubility and interaction with biological targets. Overall, this compound's unique structural features suggest potential utility in drug development and other chemical applications, although specific biological activities and properties would require further investigation.
Formula:C17H16ClN5O2
InChI:InChI=1S/C17H16ClN5O2/c1-24-13-9-5-3-7-11(13)19-16-21-15(18)22-17(23-16)20-12-8-4-6-10-14(12)25-2/h3-10H,1-2H3,(H2,19,20,21,22,23)
InChI key:InChIKey=BVTLUNCYZNMSJD-UHFFFAOYSA-N
SMILES:N(C=1N=C(NC2=C(OC)C=CC=C2)N=C(Cl)N1)C3=C(OC)C=CC=C3
Synonyms:- 1,3,5-Triazine-2,4-diamine, 6-chloro-N,N′-bis(2-methoxyphenyl)-
- 6-Chloro-N2,N4-bis(2-methoxyphenyl)-1,3,5-triazine-2,4-diamine
- 1,3,5-Triazine-2,4-diamine, 6-chloro-N2,N4-bis(2-methoxyphenyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery