CAS 627526-90-3

1-Bromo-3-difluoromethyl-5-fluorobenzene

Description:

1-Bromo-3-difluoromethyl-5-fluorobenzene, with the CAS number 627526-90-3, is an aromatic compound characterized by the presence of a bromine atom and multiple fluorine substituents on a benzene ring. This compound features a difluoromethyl group (-CF2H) at the meta position relative to the bromine atom, and a fluorine atom at the para position. The presence of these halogen substituents significantly influences its chemical properties, including increased electronegativity and potential reactivity. The compound is likely to exhibit low volatility and high stability due to the strength of the carbon-fluorine bonds. Its unique structure may impart specific characteristics such as lipophilicity and potential applications in pharmaceuticals or agrochemicals. Additionally, the presence of multiple electronegative atoms can affect its solubility in various solvents and its behavior in chemical reactions, making it a subject of interest in synthetic organic chemistry and materials science. Safety data should be consulted for handling and storage, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₄BrF₃

InChI: InChI=1S/C7H4BrF3/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3,7H

SMILES: c1c(cc(cc1Br)F)C(F)F

Synonyms:

• 3-Bromo-5-fluorodifluoromethylbenzene

1-BROMO-3-DIFLUOROMETHYL-5-FLUOROBENZENE

CAS: 627526-90-3

Formula: C₇H₄BrF₃

Purity: 97%

Color and Shape: Liquid

Molecular weight: 225.0059

Ref: IN-DA00EFZ7

1-Bromo-3-(difluoromethyl)-5-fluorobenzene

CAS: 627526-90-3

1-Bromo-3-(difluoromethyl)-5-fluorobenzene

Formula: C₇H₄BrF₃

Purity: ≥95%

Color and Shape: clear. colourless liquid

Molecular weight: 225.01g/mol

Ref: 54-PC56966

1-Bromo-3-difluoromethyl-5-fluorobenzene

CAS: 627526-90-3

Formula: C₇H₄BrF₃

Purity: 97%

Color and Shape: Liquid, Clear

Molecular weight: 225.008

Ref: 10-F033221