CAS 627526-93-6

4-Bromo-2-(difluoromethyl)thiophene

Description:

4-Bromo-2-(difluoromethyl)thiophene is an organofluorine compound characterized by the presence of a thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The compound features a bromine atom and a difluoromethyl group attached to the thiophene ring, contributing to its unique chemical properties. The bromine substituent can enhance the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and materials science. The difluoromethyl group introduces significant electronegativity, influencing the compound's electronic properties and potentially enhancing its lipophilicity. This compound is typically used in research settings, particularly in the development of pharmaceuticals and agrochemicals, due to its potential biological activity and ability to participate in further chemical transformations. Its stability and reactivity can be affected by the presence of the bromine and difluoromethyl groups, making it a subject of interest for studies involving halogenated compounds and their derivatives. Safety data should be consulted for handling and usage, as with all chemical substances.

Formula: C₅H₃BrF₂S

InChI: InChI=1S/C5H3BrF2S/c6-3-1-4(5(7)8)9-2-3/h1-2,5H

InChI key: InChIKey=FPSAHMIQBUZQQQ-UHFFFAOYSA-N

SMILES: C(F)(F)C1=CC(Br)=CS1

Synonyms:

• 4-Bromo-2-difluoromethylthiophene
• Thiophene, 4-bromo-2-(difluoromethyl)-
• 4-Bromo-2-(difluoromethyl)thiophene

4-Bromo-2-(difluoromethyl)-thiophene

CAS: 627526-93-6

Formula: C₅H₃BrF₂S

Color and Shape: Liquid

Molecular weight: 213.04

Ref: 10-F024153