CAS 627527-14-4

2-Bromo-7-(difluoromethyl)naphthalene

Description:

2-Bromo-7-(difluoromethyl)naphthalene is an organic compound characterized by its naphthalene backbone, which consists of two fused aromatic rings. The presence of a bromine atom at the second position and a difluoromethyl group at the seventh position introduces significant polarity and reactivity to the molecule. This compound is typically a solid at room temperature and may exhibit a range of physical properties such as melting and boiling points that are influenced by its molecular structure and substituents. The bromine atom can participate in nucleophilic substitution reactions, while the difluoromethyl group can enhance the compound's lipophilicity and influence its biological activity. 2-Bromo-7-(difluoromethyl)naphthalene is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in the synthesis of pharmaceuticals and functional materials. Safety data should be consulted for handling, as halogenated compounds can pose health and environmental risks.

Formula: C₁₁H₇BrF₂

InChI: InChI=1S/C11H7BrF2/c12-10-4-3-7-1-2-8(11(13)14)5-9(7)6-10/h1-6,11H

InChI key: InChIKey=BBRLRBMAPHVGPM-UHFFFAOYSA-N

SMILES: C(F)(F)C1=CC2=C(C=C1)C=CC(Br)=C2

Synonyms:

• 2-Bromo-7-(difluoromethyl)naphthalene
• Naphthalene, 2-bromo-7-(difluoromethyl)-
• 2-Bromo-7-difluoromethylnaphthalene