CAS 627536-09-8

2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine

Description:

2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine is a chemical compound characterized by its complex structure, which includes a pteridine core, a pyridine moiety, and a substituted phenyl group. The presence of chlorine and fluorine atoms on the phenyl ring contributes to its unique electronic properties and potential biological activity. This compound is likely to exhibit specific interactions with biological targets due to its ability to form hydrogen bonds and engage in π-π stacking interactions, which are common in drug-like molecules. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. The compound's solubility, stability, and reactivity will depend on its functional groups and overall molecular conformation. Additionally, the presence of halogen substituents may influence its lipophilicity and bioavailability. Overall, 2-(5-chloro-2-fluorophenyl)-N-pyridin-4-ylpteridin-4-amine represents a class of compounds that may be of interest in drug discovery and development.

Formula: C₁₇H₁₀ClFN₆

InChI: InChI=1/C17H10ClFN6/c18-10-1-2-13(19)12(9-10)15-24-16-14(21-7-8-22-16)17(25-15)23-11-3-5-20-6-4-11/h1-9H,(H,20,22,23,24,25)

SMILES: c1cc(c(cc1Cl)c1nc2c(c(N=c3cc[nH]cc3)n1)nccn2)F

Synonyms:

• 2-(5-chloro-2-fluorophenyl)-N-(pyridin-4-yl)pteridin-4-amine
• 4-Pteridinamine, 2-(5-chloro-2-fluorophenyl)-N-4-pyridinyl-
• SD-208

SD-208

CAS: 627536-09-8

Formula: C₁₇H₁₀ClFN₆

Purity: 99%

Color and Shape: Solid

Molecular weight: 352.7529

Ref: IN-DA00ECEN

SD-208

CAS: 627536-09-8

SD-208

Purity: ≥95%

Molecular weight: 352.75g/mol

Ref: 54-BUP02350

SD-208

CAS: 627536-09-8

Formula: C₁₇H₁₀ClFN₆

Molecular weight: 352.75

Ref: 7W-GL3540

2-(5-Chloro-2-Fluorophenyl)-N-(Pyridin-4-yl)Pteridin-4-Amine

CAS: 627536-09-8

2-(5-Chloro-2-Fluorophenyl)-N-(Pyridin-4-yl)Pteridin-4-Amine

Purity: 98%

Molecular weight: 352.75g/mol

Ref: 54-PC109002

SD 208

CAS: 627536-09-8

Formula: C₁₇H₁₀ClFN₆

Molecular weight: 352.76

Ref: 4Z-S-223001

SD-208

CAS: 627536-09-8

SD-208 (ALK5 Inhibitor V), a selective TGF-βRI (ALK5) inhibitor (IC50: 48 nM), is >100-fold selectivity over TGF-βRII.

Formula: C₁₇H₁₀ClFN₆

Purity: 98.72% - 99.65%

Color and Shape: Solid

Molecular weight: 352.75

Ref: TM-T2109

SCI 208

CAS: 627536-09-8

Inhibitor of ALK5 kinase

Formula: C₁₇H₁₀ClFN₆

Purity: Min. 95%

Molecular weight: 352.75 g/mol

Ref: 3D-FS99545