CAS 62773-09-5

7-(chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one

Description:

7-(Chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one is a heterocyclic compound characterized by its unique structural features, which include a thiazole ring fused to a pyrimidine moiety. This compound typically exhibits a chloromethyl group at the 7-position, contributing to its reactivity and potential applications in medicinal chemistry. The presence of the thiazole and pyrimidine rings suggests that it may possess biological activity, potentially acting as an antimicrobial or anticancer agent. Its molecular structure allows for various interactions with biological targets, making it a subject of interest in drug development. The compound is likely to be soluble in organic solvents, and its stability can be influenced by environmental factors such as pH and temperature. Additionally, the chloromethyl group can serve as a site for further chemical modifications, enhancing its utility in synthetic chemistry. Overall, 7-(chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one represents a versatile scaffold for exploring new therapeutic agents.

Formula: C₇H₅ClN₂OS

InChI: InChI=1/C7H5ClN2OS/c8-4-5-3-6(11)10-1-2-12-7(10)9-5/h1-3H,4H2

SMILES: c1csc2nc(cc(=O)n12)CCl

Synonyms:

• 5H-thiazolo[3,2-a]pyrimidin-5-one, 7-(chloromethyl)-
• 7-Chloromethyl-thiazolo[3,2-a]pyrimidin-5-one

7-CHLOROMETHYL-THIAZOLO[3,2-A]PYRIMIDIN-5-ONE

CAS: 62773-09-5

Formula: C₇H₅ClN₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.6454

Ref: IN-DA00EEAF

7-(Chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one

CAS: 62773-09-5

7-(Chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one

Purity: 98%

Molecular weight: 200.65g/mol

Ref: 54-OR1034377

7-(chloromethyl)-5H-[1,3]thiazolo[3,2-a]pyrimidin-5-one

CAS: 62773-09-5

Formula: C₇H₅ClN₂OS

Purity: 98%

Color and Shape: Solid

Molecular weight: 200.64

Ref: 10-F307671