CymitQuimica logo

CAS 62781-23-1

:

1-{3-[4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidin-1-yl]propyl}-1,3-dihydro-2H-benzimidazol-2-one

Description:
The chemical substance known as 1-{3-[4-(2-oxo-2,3-dihydro-1H-benzimidazol-1-yl)piperidin-1-yl]propyl}-1,3-dihydro-2H-benzimidazol-2-one, with the CAS number 62781-23-1, is a complex organic compound characterized by its dual benzimidazole structure, which is a bicyclic compound featuring a fused benzene and imidazole ring. This compound exhibits a piperidine moiety, contributing to its potential biological activity, particularly in medicinal chemistry. The presence of the 2-oxo group indicates that it may participate in various chemical reactions, including those involving nucleophiles. Its structural features suggest potential applications in pharmaceuticals, possibly as an antimicrobial or anticancer agent, although specific biological activities would require empirical investigation. The compound's solubility, stability, and reactivity would depend on its functional groups and the overall molecular conformation. As with many benzimidazole derivatives, it may also exhibit interesting interactions with biological targets, making it a subject of interest in drug discovery and development.
Formula:C22H25N5O2
InChI:InChI=1/C22H25N5O2/c28-21-23-17-6-1-3-8-19(17)26(21)13-5-12-25-14-10-16(11-15-25)27-20-9-4-2-7-18(20)24-22(27)29/h1-4,6-9,16H,5,10-15H2,(H,23,28)(H,24,29)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.