CAS 628-49-9
:N-(3-Methylbutyl)urea
Description:
N-(3-Methylbutyl)urea, with the CAS number 628-49-9, is an organic compound that belongs to the class of ureas, which are characterized by the presence of the functional group -NH2-C(=O)-. This particular compound features a 3-methylbutyl group attached to the nitrogen atom of the urea moiety, contributing to its unique properties. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. N-(3-Methylbutyl)urea is known for its solubility in polar solvents, which makes it useful in various chemical applications, including as a reagent in organic synthesis and as a potential intermediate in the production of pharmaceuticals. Its molecular structure allows for hydrogen bonding, influencing its physical properties such as melting and boiling points. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. Safety data should be consulted for handling and storage, as with all chemical substances, to ensure proper precautions are taken.
Formula:C6H14N2O
InChI:InChI=1S/C6H14N2O/c1-5(2)3-4-8-6(7)9/h5H,3-4H2,1-2H3,(H3,7,8,9)
InChI key:InChIKey=LLRPMCWEGQFYFB-UHFFFAOYSA-N
SMILES:C(CC(C)C)NC(N)=O
Synonyms:- (3-Methyl-butyl)-urea
- (3-Methylbutyl)urea
- Isoamylurea
- N-(3-Methylbutyl)urea
- Urea, (3-methylbutyl)-
- Urea, isopentyl-
- urea, N-(3-methylbutyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
(3-Methylbutyl)urea
CAS:<p>(3-Methylbutyl)urea is a quinoline derivative that inhibits the growth of cancer cells by binding to and inhibiting the activity of the b-raf protein tyrosine kinase. This drug has been shown to inhibit the growth of muscle cells, which may be related to its ability to block programmed cell death. (3-Methylbutyl)urea also has been shown to exhibit strong anti-inflammatory properties in animal models. It is thought that this property is due to its ability to inhibit the production of TNF-α and other inflammatory mediators. (3-Methylbutyl)urea binds strongly with bile acids, forming an insoluble complex that prevents their reabsorption from the intestine. This effect can be exploited for treatment of certain autoimmune diseases by reducing bile acid levels in the intestine.</p>Formula:C6H14N2OPurity:Min. 95%Molecular weight:130.19 g/mol
