CAS 6280-21-3

2-hydroxy-N-(2-phenylethyl)propanamide

Description:

2-Hydroxy-N-(2-phenylethyl)propanamide, also known by its CAS number 6280-21-3, is an organic compound characterized by the presence of a hydroxyl group (-OH) and an amide functional group (-C(=O)N-) within its structure. This compound features a propanamide backbone with a hydroxy substituent at the second carbon and a phenylethyl group attached to the nitrogen atom. The presence of the hydroxyl group contributes to its potential solubility in polar solvents and may influence its reactivity and hydrogen bonding capabilities. The phenylethyl moiety adds to the compound's hydrophobic characteristics, which can affect its biological activity and interactions with other molecules. This compound may exhibit properties such as being a potential intermediate in organic synthesis or having applications in pharmaceuticals, given the structural motifs commonly associated with bioactive compounds. Its specific physical and chemical properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₁H₁₅NO₂

InChI: InChI=1/C11H15NO2/c1-9(13)11(14)12-8-7-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3,(H,12,14)

SMILES: CC(C(=NCCc1ccccc1)O)O

2-Hydroxy-N-(2-phenylethyl)propanamide

CAS: 6280-21-3

Versatile small molecule scaffold

Formula: C₁₁H₁₅NO₂

Purity: Min. 95%

Molecular weight: 193.24 g/mol

Ref: 3D-GAA28021