CAS 6280-31-5: 1-butyl-1H-tetrazol-5-amine

Description: 1-Butyl-1H-tetrazol-5-amine, with the CAS number 6280-31-5, is a chemical compound characterized by its tetrazole ring structure, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound typically exhibits properties associated with both amines and heterocycles, including potential basicity due to the presence of the amine group. It is often used in various applications, including pharmaceuticals and agrochemicals, due to its ability to act as a building block in organic synthesis. The butyl group contributes to its hydrophobic characteristics, influencing its solubility and reactivity. Additionally, the presence of the tetrazole moiety can impart unique biological activities, making it of interest in medicinal chemistry. The compound is generally stable under standard conditions but may require careful handling due to the potential reactivity of the nitrogen-containing heterocycle. Overall, 1-butyl-1H-tetrazol-5-amine is a versatile compound with significant implications in chemical research and development.

Formula: C₅H₁₁N₅

InChI: InChI=1/C5H11N5/c1-2-3-4-10-5(6)7-8-9-10/h2-4H2,1H3,(H2,6,7,9)

Synonyms:

• 1H-Tetrazol-5-amine, 1-butyl-

1-Butyl-1H-tetrazole-5-amine

CAS: 6280-31-5

• Purity: 95.0%
• Molecular weight: 141.17799377441406

1-Butyl-1H-tetrazol-5-amine

CAS: 6280-31-5

Versatile small molecule scaffold

• Formula: C₅H₁₁N₅
• Purity: Min. 95%
• Molecular weight: 141.17 g/mol