CAS 6280-80-4
:(2-Formylphenoxy)acetic acid
Description:
(2-Formylphenoxy)acetic acid, with the CAS number 6280-80-4, is an organic compound characterized by its aromatic structure and functional groups. It features a phenoxy group, which is a phenyl ring bonded to an oxygen atom, and an acetic acid moiety, which contributes to its acidic properties. This compound typically appears as a white to light yellow solid and is soluble in polar solvents due to the presence of the carboxylic acid group. Its molecular structure allows for potential hydrogen bonding, influencing its reactivity and interactions with other substances. (2-Formylphenoxy)acetic acid is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity and applications in synthesis. The presence of both the aldehyde and carboxylic acid functional groups suggests that it may participate in various chemical reactions, such as condensation and esterification. Overall, this compound's unique structure and functional characteristics make it a valuable subject of study in organic chemistry.
Formula:C9H8O4
InChI:InChI=1S/C9H8O4/c10-5-7-3-1-2-4-8(7)13-6-9(11)12/h1-5H,6H2,(H,11,12)
InChI key:InChIKey=ANWMNLAAFDCKMT-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(C=O)C=CC=C1
Synonyms:- Acetic acid, (2-formylphenoxy)-
- 2-(2-Formylphenoxy)acetic acid
- o-Formylphenoxyacetic acid
- Acetic acid, (o-formylphenoxy)-
- Acetic acid, 2-(2-formylphenoxy)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(2-Formylphenoxy)acetic acid
CAS:Formula:C9H8O4Purity:97%Color and Shape:SolidMolecular weight:180.15742-Formylphenoxyacetic acid
CAS:2-Formylphenoxyacetic acid (FPAA) is a molecule that belongs to the group of p2 molecules. It has been detected in urine samples and can be used as a marker for urinary tract infections. FPAA is an electrochemical detector for copper complexes and has been shown to have antimicrobial activity against Staphylococcus, amines, and carboxylates. The mechanism of its antimicrobial activity may involve hydrogen bonding interactions with the negatively charged groups on the cell wall of bacteria. Chemical structures and structural analysis have shown that FPAA contains two aldehyde groups linked by an ether bond.
Formula:C9H8O4Purity:Min. 95%Color and Shape:PowderMolecular weight:180.16 g/mol



