CAS 62802-38-4
:5-Bromo-2-fluoropyrimidine
Description:
5-Bromo-2-fluoropyrimidine is a heterocyclic organic compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of bromine and fluorine substituents at the 5 and 2 positions, respectively, significantly influences its chemical properties and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role in medicinal chemistry and as an intermediate in the synthesis of various pharmaceuticals and agrochemicals. The halogen substituents enhance its electrophilic character, making it a useful building block in nucleophilic substitution reactions. Additionally, 5-Bromo-2-fluoropyrimidine exhibits moderate solubility in polar organic solvents, which facilitates its use in various chemical reactions. Safety precautions should be taken when handling this compound, as it may pose health risks due to its halogenated nature. Overall, its unique structure and reactivity make it a valuable compound in synthetic organic chemistry.
Formula:C4H2BrFN2
InChI:InChI=1S/C4H2BrFN2/c5-3-1-7-4(6)8-2-3/h1-2H
InChI key:InChIKey=CTWZYPZCDJKBRS-UHFFFAOYSA-N
SMILES:BrC=1C=NC(F)=NC1
Synonyms:- 2-Chlor-5-Bromopyrimidin
- 2-Fluoro-5-bromopyrimidine
- Pyrimidine, 5-bromo-2-fluoro-
- 5-Bromo-2-fluoropyrimidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Bromo-2-fluoropyrimidine
CAS:Formula:C4H2BrFN2Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:176.985-Bromo-2-fluoropyrimidine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C4H2BrFN2Purity:95%Color and Shape:White to pale cream or pale cream, Crystals or powder or crystalline powderMolecular weight:176.985-bromo-2-fluoropyrimidine
CAS:Formula:C4H2BrFN2Purity:97%Color and Shape:SolidMolecular weight:176.97455-Bromo-2-fluoropyrimidine
CAS:5-Bromo-2-fluoropyrimidineFormula:C4H2BrFN2Purity:≥95%Color and Shape: white powderMolecular weight:176.97g/mol5-Bromo-2-fluoropyrimidine
CAS:Formula:C4H2BrFN2Purity:97%Color and Shape:Very pale yellow to pale yellow solidMolecular weight:176.976





