CAS 62802-42-0
:2-CHLORO-5-FLUOROPYRIMIDINE
Description:
2-Chloro-5-fluoropyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with chlorine and fluorine atoms. The presence of these halogen substituents significantly influences its chemical reactivity and properties. Typically, this compound appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its role in medicinal chemistry, particularly in the synthesis of various pharmaceuticals and agrochemicals. The chlorine atom at the 2-position and the fluorine atom at the 5-position contribute to its biological activity, making it a valuable intermediate in the development of antiviral and anticancer agents. Additionally, 2-chloro-5-fluoropyrimidine exhibits moderate solubility in polar organic solvents, which facilitates its use in various chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested. Overall, its unique structure and reactivity make it an important compound in synthetic organic chemistry.
Formula:C6H3ClFNO2
InChI:InChI=1/C6H3ClFNO2/c7-5-4(8)3(6(10)11)1-2-9-5/h1-2H,(H,10,11)
SMILES:c1cnc(c(c1C(=O)O)F)Cl
Synonyms:- 2-Chloro-5Fluoro-Pyrimidine
- Pyrimidine, 2-chloro-5-fluoro-
- 5-Fluoro-2-chloropyrimidine
- 2-Chlor-5-fluorpyrimidin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Chloro-5-fluoropyrimidine
CAS:Formula:C4H2ClFN2Purity:>98.0%(GC)Color and Shape:Colorless to Light yellow to Light orange clear liquidMolecular weight:132.522-Chloro-5-fluoropyrimidine 98%
CAS:Formula:C4H2ClFN2Color and Shape:Liquid or Solid or Semi-solid or lumpMolecular weight:132.522-Chloro-5-fluoropyrimidine, 97%
CAS:<p>2-Chloro-5-fluoropyrimidine is used to prepare 2,4-disubstituted-5-fluoropyrimidine , which is a biologically active molecule seen in anticancer agents like 5-fluorouracil. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and </p>Formula:C4H2ClFN2Purity:97%Molecular weight:132.522-Chloro-5-Fluoropyrimidine
CAS:Formula:C4H2ClFN2Purity:97%Color and Shape:LiquidMolecular weight:132.52352-Chloro-5-fluoropyrimidine
CAS:2-Chloro-5-fluoropyrimidineFormula:C4H2ClFN2Purity:98%Color and Shape: clear. colourless liquidMolecular weight:132.52g/mol2-Chloro-5-fluoropyrimidine
CAS:Formula:C4H2ClFN2Purity:97%Color and Shape:LiquidMolecular weight:132.52





