CAS 62806-35-3

2-Propenoic acid, 3-[5-(4-bromophenyl)-2-furanyl]-, (E)-

Description:

2-Propenoic acid, 3-[5-(4-bromophenyl)-2-furanyl]-, (E)-, also known by its CAS number 62806-35-3, is an organic compound characterized by its structure, which includes a propenoic acid moiety and a substituted furan ring. This compound features a double bond in the propenoic acid part, indicating its potential for polymerization and reactivity in various chemical reactions. The presence of the 4-bromophenyl group enhances its electronic properties, potentially influencing its reactivity and solubility. The (E)- configuration denotes the specific geometric arrangement of substituents around the double bond, which can affect the compound's physical and chemical properties, such as boiling point and reactivity. Generally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry and materials science. Additionally, the furan ring contributes to the compound's aromatic characteristics, which can further influence its interactions in chemical processes. Overall, this compound's unique structure suggests a range of potential applications in various fields, including organic synthesis and pharmaceuticals.

Formula: C₁₃H₉BrO₃

InChI: InChI=1S/C13H9BrO3/c14-10-3-1-9(2-4-10)12-7-5-11(17-12)6-8-13(15)16/h1-8H,(H,15,16)/b8-6+

InChI key: InChIKey=UWJPYZVCZQFJDI-SOFGYWHQSA-N

SMILES: C(=C/C(O)=O)\C=1OC(=CC1)C2=CC=C(Br)C=C2

Synonyms:

• (2E)-3-[5-(4-Bromophenyl)-2-furanyl]-2-propenoic acid
• 2-Propenoic acid, 3-[5-(4-bromophenyl)-2-furanyl]-, (2E)-
• 2-Propenoic acid, 3-[5-(4-bromophenyl)-2-furanyl]-, (E)-

(2E)-3-[5-(4-Bromophenyl)furan-2-yl]prop-2-enoic acid

CAS: 62806-35-3

Versatile small molecule scaffold

Formula: C₁₃H₉BrO₃

Purity: Min. 95%

Molecular weight: 293.11 g/mol

Ref: 3D-MCA80635