CymitQuimica logo

CAS 6281-58-9

:

7-chloro-4-(2-methylpyrrolidin-1-yl)quinoline

Description:
7-Chloro-4-(2-methylpyrrolidin-1-yl)quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 7-position and a 2-methylpyrrolidin-1-yl group at the 4-position contributes to its unique properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. It is of interest in medicinal chemistry due to its potential biological activities, which may include antimicrobial or antitumor properties. The molecular structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity. As with any chemical, its behavior in reactions and interactions with other substances can vary widely based on environmental conditions and the presence of other reactants.
Formula:C14H15ClN2
InChI:InChI=1/C14H15ClN2/c1-10-3-2-8-17(10)14-6-7-16-13-9-11(15)4-5-12(13)14/h4-7,9-10H,2-3,8H2,1H3
InChI key:GYORBDCAYLXAIL-UHFFFAOYSA-N
SMILES:CC1CCCN1c1ccnc2cc(ccc12)Cl
Synonyms:
  • 7-Chloro-4-(2-methyl-1-pyrrolidinyl)quinoline
  • Quinoline, 7-chloro-4- (2-methyl-1-pyrrolidinyl)-
  • 7-Chloro-4-(2-methylpyrrolidin-1-yl)quinoline
Found 7 products.