CAS 62812-42-4
:methyl (2R,3S,4S,5S,6S)-3,4,5-triacetoxy-6-phenylsulfanyl-tetrahydropyran-2-carboxylate
Description:
Methyl (2R,3S,4S,5S,6S)-3,4,5-triacetoxy-6-phenylsulfanyl-tetrahydropyran-2-carboxylate is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetoxy groups, which contribute to its reactivity and solubility in organic solvents. The presence of a phenylsulfanyl group introduces a sulfur atom into the structure, enhancing its potential for various chemical reactions, such as nucleophilic substitutions. The stereochemistry indicated by the (2R,3S,4S,5S,6S) configuration suggests that the compound exhibits chirality, which can influence its biological activity and interactions with other molecules. This compound may be of interest in synthetic organic chemistry and medicinal chemistry due to its potential applications in drug development or as a building block for more complex molecules. Its specific properties, such as melting point, boiling point, and solubility, would depend on the overall molecular structure and the presence of functional groups.
Formula:C19H22O9S
InChI:InChI=1/C19H22O9S/c1-10(20)25-14-15(26-11(2)21)17(27-12(3)22)19(28-16(14)18(23)24-4)29-13-8-6-5-7-9-13/h5-9,14-17,19H,1-4H3/t14-,15-,16+,17-,19-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl (Phenyl 2,3,4-Tri-O-acetyl-1-thio-β-D-glucopyranosid)uronate
CAS:Formula:C19H22O9SPurity:>98.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:426.44Methyl (phenyl 2,3,4-tri-o-acetyl-1-thio-β-d-glucopyranosid)uronate
CAS:Formula:C19H22O9SPurity:98%Color and Shape:SolidMolecular weight:426.4376Methyl (Phenyl 2,3,4-Tri-O-Acetyl-1-Thio-β-D-Glucopyranosid)Uronate
CAS:Methyl (Phenyl 2,3,4-Tri-O-Acetyl-1-Thio-β-D-Glucopyranosid)UronatePurity:98%Molecular weight:426.44g/molPhenyl 1-thio-β-D-glucopyranosiduronic Acid Methyl Ester 2,3,4-Triacetate
CAS:Controlled ProductFormula:C19H22O9SColor and Shape:NeatMolecular weight:426.438Methyl (Phenyl 2,3,4-Tri-O-acetyl-1-thio-b-D-glucopyranosid)uronate
CAS:Methyl (Phenyl 2,3,4-Tri-O-acetyl-1-thio-b-D-glucopyranosid)uronate is a modified sugar that can be used as a building block to synthesize complex carbohydrates. It is an important intermediate for the synthesis of saccharides and oligosaccharides. This product is a white powder with a molecular weight of 594.87. Methyl (Phenyl 2,3,4-Tri-O-acetyl-1-thio-b-D-glucopyranosid)uronate has been assigned CAS No. 62812-42-4 and has been approved for use in food production.Formula:C19H22O9SPurity:Min. 95%Molecular weight:426.44 g/mol




