
CAS 62816-98-2
:(OC-6-22)-Tetrachloro[rel-(1R,2R)-1,2-cyclohexanediamine-κN1,κN2]platinum
Description:
(Tetrachloro[rel-(1R,2R)-1,2-cyclohexanediamine-κN1,κN2]platinum), with the CAS number 62816-98-2, is a coordination compound of platinum characterized by its complex structure involving a platinum center coordinated to four chloride ligands and a bidentate ligand derived from cyclohexanediamine. This compound exhibits a square planar geometry typical of platinum(II) complexes, which is crucial for its reactivity and interaction with biological molecules. The presence of the cyclohexanediamine ligand introduces chirality, resulting in specific stereoisomers that can influence the compound's biological activity and pharmacological properties. Such platinum complexes are of interest in medicinal chemistry, particularly in the development of anticancer agents, as they can interact with DNA and disrupt cellular processes. The stability of the chlorido ligands and the overall solubility of the compound in various solvents can vary, affecting its application in research and therapeutic contexts. Overall, this compound exemplifies the intricate relationship between coordination chemistry and biological activity.
Formula:C6H14Cl4N2Pt
InChI:InChI=1/C6H14N2.4ClH.Pt/c7-5-3-1-2-4-6(5)8;;;;;/h5-6H,1-4,7-8H2;4*1H;/q;;;;;+4/p-4/t5-,6-;;;;;/s2
InChI key:InChIKey=VPOCYEOOFRNHNL-CVBDPYRTNA-J
SMILES:[Cl-][Pt+4]1([Cl-])([Cl-])([Cl-])[NH2][C@]2([C@]([NH2]1)(CCCC2)[H])[H]
Synonyms:- 1,2-Cyclohexanediamine, platinum complex, trans-
- Platinum, tetrachloro[rel-(1R,2R)-1,2-cyclohexanediamine-κN1,κN2]-, (OC-6-22)-
- Platinum, tetrachloro(1,2-cyclohexanediamine-κN,κN′)-, [OC-6-22-(trans)]-
- (OC-6-22)-Tetrachloro[rel-(1R,2R)-1,2-cyclohexanediamine-κN1,κN2]platinum
- Platinum, tetrachloro[rel-(1R,2R)-1,2-cyclohexanediamine-κN,κN′]-, (OC-6-22)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ormaplatin
CAS:Ormaplatin, a platinum(IV) analog, alkylates DNA to block replication and transcription, causing cell-cycle-independent cancer cell death.Formula:C6H14Cl4N2PtColor and Shape:SolidMolecular weight:451.08
