CAS 6282-42-4

methyl 2-(prop-2-en-1-yloxy)benzoate

Description:

Methyl 2-(prop-2-en-1-yloxy)benzoate, with the CAS number 6282-42-4, is an organic compound that belongs to the class of esters. It is characterized by the presence of a methoxy group and an allyloxy group attached to a benzoate structure. This compound typically appears as a colorless to pale yellow liquid with a pleasant odor. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water due to its hydrophobic aromatic ring. Methyl 2-(prop-2-en-1-yloxy)benzoate can undergo various chemical reactions, including polymerization, due to the presence of the allyl group, making it useful in the synthesis of polymers and other organic compounds. Additionally, it may exhibit biological activity, which can be of interest in fields such as medicinal chemistry and materials science. Proper handling and safety precautions should be observed, as with any chemical substance, to mitigate potential hazards associated with its use.

Formula: C₁₁H₁₂O₃

InChI: InChI=1/C11H12O3/c1-3-8-14-10-7-5-4-6-9(10)11(12)13-2/h3-7H,1,8H2,2H3

SMILES: C=CCOc1ccccc1C(=O)OC

Methyl 2-(prop-2-en-1-yloxy)benzoate

CAS: 6282-42-4

Methyl 2-(prop-2-en-1-yloxy)benzoate is a magnesium ion recycler that is used to cleave bonds in organometallic compounds. It has been shown to catalyze bond cleavage of allyl ethers with magnesium ions and electrochemically generate propylene oxide from propylene. Methyl 2-(prop-2-en-1-yloxy)benzoate can be used as an alternative to the traditional ferrocene/triethylamine system for electrogenerated chemoselective reactions.

Formula: C₁₁H₁₂O₃

Purity: Min. 95%

Molecular weight: 192.21 g/mol

Ref: 3D-GAA28242